C20H20Br2N2O3 — CID 87558866
(2E)-2-[2-[[4-(2,2-dibromoethenyl)-2-methylphenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 87558866) has the molecular formula C20H20Br2N2O3 and a molecular weight of 496.20 g/mol. Its IUPAC name is (2E)-2-[2-[[4-(2,2-dibromoethenyl)-2-methylphenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2E)-2-[2-[[4-(2,2-dibromoethenyl)-2-methylphenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 87558866 |
| Molecular Formula | C20H20Br2N2O3 |
| Molecular Weight | 496.20 g/mol |
| Exact Mass | 493.98 |
| IUPAC Name | (2E)-2-[2-[[4-(2,2-dibromoethenyl)-2-methylphenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N/OC)c1ccccc1COc1ccc(C=C(Br)Br)cc1C |
| InChI | InChI=1S/C20H20Br2N2O3/c1-13-10-14(11-18(21)22)8-9-17(13)27-12-15-6-4-5-7-16(15)19(24-26-3)20(25)23-2/h4-11H,12H2,1-3H3,(H,23,25)/b24-19+ |
| InChIKey | QYBNDAAZXDDGAU-LYBHJNIJSA-N |
| XLogP | 4.76 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.20 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|