C19H17Br3N2O3 — CID 90720124
2-[2-[[2-bromo-4-(2,2-dibromoethenyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 90720124) has the molecular formula C19H17Br3N2O3 and a molecular weight of 561.07 g/mol. Its IUPAC name is 2-[2-[[2-bromo-4-(2,2-dibromoethenyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | 2-[2-[[2-bromo-4-(2,2-dibromoethenyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 90720124 |
| Molecular Formula | C19H17Br3N2O3 |
| Molecular Weight | 561.07 g/mol |
| Exact Mass | 557.88 |
| IUPAC Name | 2-[2-[[2-bromo-4-(2,2-dibromoethenyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)C(=NOC)c1ccccc1COc1ccc(C=C(Br)Br)cc1Br |
| InChI | InChI=1S/C19H17Br3N2O3/c1-23-19(25)18(24-26-2)14-6-4-3-5-13(14)11-27-16-8-7-12(9-15(16)20)10-17(21)22/h3-10H,11H2,1-2H3,(H,23,25) |
| InChIKey | GALLRGSDWOKUJX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.07 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|