C27H25FIN3O4 — CID 173138833
2-[2-[[[1-[3-(1-fluoro-2-phenylethenoxy)phenyl]-2-iodoethylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 173138833) has the molecular formula C27H25FIN3O4 and a molecular weight of 601.42 g/mol. Its IUPAC name is 2-[2-[[[1-[3-(1-fluoro-2-phenylethenoxy)phenyl]-2-iodoethylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | 2-[2-[[[1-[3-(1-fluoro-2-phenylethenoxy)phenyl]-2-iodoethylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 173138833 |
| Molecular Formula | C27H25FIN3O4 |
| Molecular Weight | 601.42 g/mol |
| Exact Mass | 601.09 |
| IUPAC Name | 2-[2-[[[1-[3-(1-fluoro-2-phenylethenoxy)phenyl]-2-iodoethylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)C(=NOC)c1ccccc1CON=C(CI)c1cccc(OC(F)=Cc2ccccc2)c1 |
| InChI | InChI=1S/C27H25FIN3O4/c1-30-27(33)26(32-34-2)23-14-7-6-11-21(23)18-35-31-24(17-29)20-12-8-13-22(16-20)36-25(28)15-19-9-4-3-5-10-19/h3-16H,17-18H2,1-2H3,(H,30,33) |
| InChIKey | MCGKDUQOOVRPOD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|