C27H26FN3O4 — CID 173055897
2-[2-[[1-[3-[(E)-1-fluoro-2-phenylethenoxy]phenyl]ethenylamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 173055897) has the molecular formula C27H26FN3O4 and a molecular weight of 475.52 g/mol. Its IUPAC name is 2-[2-[[1-[3-[(E)-1-fluoro-2-phenylethenoxy]phenyl]ethenylamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | 2-[2-[[1-[3-[(E)-1-fluoro-2-phenylethenoxy]phenyl]ethenylamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 173055897 |
| Molecular Formula | C27H26FN3O4 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-[2-[[1-[3-[(E)-1-fluoro-2-phenylethenoxy]phenyl]ethenylamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | C=C(NOCc1ccccc1C(=NOC)C(=O)NC)c1cccc(O/C(F)=C\c2ccccc2)c1 |
| InChI | InChI=1S/C27H26FN3O4/c1-19(21-13-9-14-23(17-21)35-25(28)16-20-10-5-4-6-11-20)30-34-18-22-12-7-8-15-24(22)26(31-33-3)27(32)29-2/h4-17,30H,1,18H2,2-3H3,(H,29,32)/b25-16-,31-26? |
| InChIKey | PWDQHECXYAXALU-OHXUDCROSA-N |
| XLogP | 4.82 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|