C21H21ClFN3O3 — CID 90819459
2-[2-[[1-[4-(2-chloro-2-fluoroethenyl)phenyl]ethenylamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 90819459) has the molecular formula C21H21ClFN3O3 and a molecular weight of 417.87 g/mol. Its IUPAC name is 2-[2-[[1-[4-(2-chloro-2-fluoroethenyl)phenyl]ethenylamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | 2-[2-[[1-[4-(2-chloro-2-fluoroethenyl)phenyl]ethenylamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 90819459 |
| Molecular Formula | C21H21ClFN3O3 |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[2-[[1-[4-(2-chloro-2-fluoroethenyl)phenyl]ethenylamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | C=C(NOCc1ccccc1C(=NOC)C(=O)NC)c1ccc(C=C(F)Cl)cc1 |
| InChI | InChI=1S/C21H21ClFN3O3/c1-14(16-10-8-15(9-11-16)12-19(22)23)25-29-13-17-6-4-5-7-18(17)20(26-28-3)21(27)24-2/h4-12,25H,1,13H2,2-3H3,(H,24,27) |
| InChIKey | IWMAWZCUCCWSDV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|