C22H25FN4O4 — CID 59041141
2-[2-[[[(1Z)-1-(4-fluorophenyl)-1-methoxyiminobutan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 59041141) has the molecular formula C22H25FN4O4 and a molecular weight of 428.46 g/mol. Its IUPAC name is 2-[2-[[[(1Z)-1-(4-fluorophenyl)-1-methoxyiminobutan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | 2-[2-[[[(1Z)-1-(4-fluorophenyl)-1-methoxyiminobutan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 59041141 |
| Molecular Formula | C22H25FN4O4 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-[2-[[[(1Z)-1-(4-fluorophenyl)-1-methoxyiminobutan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CCC(=NOCc1ccccc1C(=NOC)C(=O)NC)/C(=N\OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN4O4/c1-5-19(20(26-29-3)15-10-12-17(23)13-11-15)25-31-14-16-8-6-7-9-18(16)21(27-30-4)22(28)24-2/h6-13H,5,14H2,1-4H3,(H,24,28)/b25-19?,26-20-,27-21? |
| InChIKey | ZPSQLXYVQXFSEM-WRYKEPKLSA-N |
| XLogP | 3.26 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|