C23H26FN3O3 — CID 87950243
2-[2-[[1-[(1R,2R)-2-(4-fluorophenyl)-2-methylcyclopropyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 87950243) has the molecular formula C23H26FN3O3 and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-[2-[[1-[(1R,2R)-2-(4-fluorophenyl)-2-methylcyclopropyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | 2-[2-[[1-[(1R,2R)-2-(4-fluorophenyl)-2-methylcyclopropyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 87950243 |
| Molecular Formula | C23H26FN3O3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-[2-[[1-[(1R,2R)-2-(4-fluorophenyl)-2-methylcyclopropyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)C(=NOC)c1ccccc1CON=C(C)[C@@H]1C[C@@]1(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN3O3/c1-15(20-13-23(20,2)17-9-11-18(24)12-10-17)26-30-14-16-7-5-6-8-19(16)21(27-29-4)22(28)25-3/h5-12,20H,13-14H2,1-4H3,(H,25,28)/t20-,23-/m0/s1 |
| InChIKey | DDVKPYRFCQTOPK-REWPJTCUSA-N |
| XLogP | 3.79 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|