C28H27F3N4O5 — CID 57300176
2-methoxyimino-2-[2-[[[3-methoxyimino-3-[4-[3-(trifluoromethyl)phenoxy]phenyl]prop-1-en-2-yl]amino]oxymethyl]phenyl]-N-methylacetamide (PubChem CID 57300176) has the molecular formula C28H27F3N4O5 and a molecular weight of 556.54 g/mol. Its IUPAC name is 2-methoxyimino-2-[2-[[[3-methoxyimino-3-[4-[3-(trifluoromethyl)phenoxy]phenyl]prop-1-en-2-yl]amino]oxymethyl]phenyl]-N-methylacetamide.
| Compound Name | 2-methoxyimino-2-[2-[[[3-methoxyimino-3-[4-[3-(trifluoromethyl)phenoxy]phenyl]prop-1-en-2-yl]amino]oxymethyl]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 57300176 |
| Molecular Formula | C28H27F3N4O5 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 2-methoxyimino-2-[2-[[[3-methoxyimino-3-[4-[3-(trifluoromethyl)phenoxy]phenyl]prop-1-en-2-yl]amino]oxymethyl]phenyl]-N-methylacetamide |
| SMILES | C=C(NOCc1ccccc1C(=NOC)C(=O)NC)C(=NOC)c1ccc(Oc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C28H27F3N4O5/c1-18(33-39-17-20-8-5-6-11-24(20)26(35-38-4)27(36)32-2)25(34-37-3)19-12-14-22(15-13-19)40-23-10-7-9-21(16-23)28(29,30)31/h5-16,33H,1,17H2,2-4H3,(H,32,36) |
| InChIKey | ZCTTZOTVTVHENL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|