C28H26FNO5 — CID 172940524
methyl (E)-2-[2-[[(E)-1-[3-(1-fluoro-2-phenylethenoxy)phenyl]ethylideneamino]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 172940524) has the molecular formula C28H26FNO5 and a molecular weight of 475.52 g/mol. Its IUPAC name is methyl (E)-2-[2-[[(E)-1-[3-(1-fluoro-2-phenylethenoxy)phenyl]ethylideneamino]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[(E)-1-[3-(1-fluoro-2-phenylethenoxy)phenyl]ethylideneamino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 172940524 |
| Molecular Formula | C28H26FNO5 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | methyl (E)-2-[2-[[(E)-1-[3-(1-fluoro-2-phenylethenoxy)phenyl]ethylideneamino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1CO/N=C(\C)c1cccc(OC(F)=Cc2ccccc2)c1 |
| InChI | InChI=1S/C28H26FNO5/c1-20(22-13-9-14-24(17-22)35-27(29)16-21-10-5-4-6-11-21)30-34-18-23-12-7-8-15-25(23)26(19-32-2)28(31)33-3/h4-17,19H,18H2,1-3H3/b26-19+,27-16?,30-20+ |
| InChIKey | CFJAEURGCCCKAM-BACYIUNBSA-N |
| XLogP | 6.13 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|