C27H27FN2O4 — CID 173469814
2-[2-[[1-[3-(1-fluoro-2-phenylethenoxy)phenyl]ethylideneamino]oxymethyl]phenyl]-3-methoxypropanamide (PubChem CID 173469814) has the molecular formula C27H27FN2O4 and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-[2-[[1-[3-(1-fluoro-2-phenylethenoxy)phenyl]ethylideneamino]oxymethyl]phenyl]-3-methoxypropanamide.
| Compound Name | 2-[2-[[1-[3-(1-fluoro-2-phenylethenoxy)phenyl]ethylideneamino]oxymethyl]phenyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 173469814 |
| Molecular Formula | C27H27FN2O4 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 2-[2-[[1-[3-(1-fluoro-2-phenylethenoxy)phenyl]ethylideneamino]oxymethyl]phenyl]-3-methoxypropanamide |
| SMILES | COCC(C(N)=O)c1ccccc1CON=C(C)c1cccc(OC(F)=Cc2ccccc2)c1 |
| InChI | InChI=1S/C27H27FN2O4/c1-19(30-33-17-22-11-6-7-14-24(22)25(18-32-2)27(29)31)21-12-8-13-23(16-21)34-26(28)15-20-9-4-3-5-10-20/h3-16,25H,17-18H2,1-2H3,(H2,29,31) |
| InChIKey | KGVWGVTXIDZLCS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|