C21H20F3NO3S — CID 11826010
methyl (E)-3-methylsulfanyl-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]prop-2-enoate (PubChem CID 11826010) has the molecular formula C21H20F3NO3S and a molecular weight of 423.46 g/mol. Its IUPAC name is methyl (E)-3-methylsulfanyl-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-methylsulfanyl-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11826010 |
| Molecular Formula | C21H20F3NO3S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | methyl (E)-3-methylsulfanyl-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C(=C/SC)c1ccccc1CO/N=C(\C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F3NO3S/c1-14(15-8-6-9-17(11-15)21(22,23)24)25-28-12-16-7-4-5-10-18(16)19(13-29-3)20(26)27-2/h4-11,13H,12H2,1-3H3/b19-13+,25-14+ |
| InChIKey | FTIFHYKSPWESQU-GXKJASEASA-N |
| XLogP | 5.52 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|