C25H24F3NO3 — CID 166811841
methyl (Z)-2-[3-ethynyl-2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]hex-2-enoate (PubChem CID 166811841) has the molecular formula C25H24F3NO3 and a molecular weight of 443.47 g/mol. Its IUPAC name is methyl (Z)-2-[3-ethynyl-2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]hex-2-enoate.
| Compound Name | methyl (Z)-2-[3-ethynyl-2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]hex-2-enoate |
|---|---|
| PubChem CID | 166811841 |
| Molecular Formula | C25H24F3NO3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | methyl (Z)-2-[3-ethynyl-2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]hex-2-enoate |
| SMILES | C#Cc1cccc(/C(=C/CCC)C(=O)OC)c1CO/N=C(\C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F3NO3/c1-5-7-13-22(24(30)31-4)21-14-9-10-18(6-2)23(21)16-32-29-17(3)19-11-8-12-20(15-19)25(26,27)28/h2,8-15H,5,7,16H2,1,3-4H3/b22-13-,29-17+ |
| InChIKey | HKQCDPXXEMKPSU-DETRBIFQSA-N |
| XLogP | 5.98 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|