C30H38F3NO2 — CID 166811888
(Z)-2-methyl-6-[3-methyl-2-[[(E)-[2-methyl-1-[3-(trifluoromethyl)phenyl]propylidene]amino]oxymethyl]phenyl]dec-6-en-5-one (PubChem CID 166811888) has the molecular formula C30H38F3NO2 and a molecular weight of 501.63 g/mol. Its IUPAC name is (Z)-2-methyl-6-[3-methyl-2-[[(E)-[2-methyl-1-[3-(trifluoromethyl)phenyl]propylidene]amino]oxymethyl]phenyl]dec-6-en-5-one.
| Compound Name | (Z)-2-methyl-6-[3-methyl-2-[[(E)-[2-methyl-1-[3-(trifluoromethyl)phenyl]propylidene]amino]oxymethyl]phenyl]dec-6-en-5-one |
|---|---|
| PubChem CID | 166811888 |
| Molecular Formula | C30H38F3NO2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | (Z)-2-methyl-6-[3-methyl-2-[[(E)-[2-methyl-1-[3-(trifluoromethyl)phenyl]propylidene]amino]oxymethyl]phenyl]dec-6-en-5-one |
| SMILES | CCC/C=C(\C(=O)CCC(C)C)c1cccc(C)c1CO/N=C(/c1cccc(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C30H38F3NO2/c1-7-8-14-26(28(35)17-16-20(2)3)25-15-9-11-22(6)27(25)19-36-34-29(21(4)5)23-12-10-13-24(18-23)30(31,32)33/h9-15,18,20-21H,7-8,16-17,19H2,1-6H3/b26-14-,34-29+ |
| InChIKey | VXIILYVUEBVEOH-IZTIRYCKSA-N |
| XLogP | 8.78 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|