C22H24F3N5O2 — CID 118459384
1-methyl-4-[3-methyl-2-[[[3-methyl-1-[3-(trifluoromethyl)phenyl]butylidene]amino]oxymethyl]phenyl]tetrazol-5-one (PubChem CID 118459384) has the molecular formula C22H24F3N5O2 and a molecular weight of 447.46 g/mol. Its IUPAC name is 1-methyl-4-[3-methyl-2-[[[3-methyl-1-[3-(trifluoromethyl)phenyl]butylidene]amino]oxymethyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-methyl-2-[[[3-methyl-1-[3-(trifluoromethyl)phenyl]butylidene]amino]oxymethyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 118459384 |
| Molecular Formula | C22H24F3N5O2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 1-methyl-4-[3-methyl-2-[[[3-methyl-1-[3-(trifluoromethyl)phenyl]butylidene]amino]oxymethyl]phenyl]tetrazol-5-one |
| SMILES | Cc1cccc(-n2nnn(C)c2=O)c1CON=C(CC(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H24F3N5O2/c1-14(2)11-19(16-8-6-9-17(12-16)22(23,24)25)26-32-13-18-15(3)7-5-10-20(18)30-21(31)29(4)27-28-30/h5-10,12,14H,11,13H2,1-4H3 |
| InChIKey | BFJUKJNTKQEHRH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|