C19H18F3N5O2S — CID 118412040
1-methyl-4-[3-methylsulfanyl-2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]tetrazol-5-one (PubChem CID 118412040) has the molecular formula C19H18F3N5O2S and a molecular weight of 437.45 g/mol. Its IUPAC name is 1-methyl-4-[3-methylsulfanyl-2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-methylsulfanyl-2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 118412040 |
| Molecular Formula | C19H18F3N5O2S |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1-methyl-4-[3-methylsulfanyl-2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]tetrazol-5-one |
| SMILES | CSc1cccc(-n2nnn(C)c2=O)c1CO/N=C(\C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3N5O2S/c1-12(13-6-4-7-14(10-13)19(20,21)22)23-29-11-15-16(8-5-9-17(15)30-3)27-18(28)26(2)24-25-27/h4-10H,11H2,1-3H3/b23-12+ |
| InChIKey | PWEDQPKHVLLZQE-FSJBWODESA-N |
| XLogP | 3.65 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|