C18H17Cl2N5O2 — CID 172956426
1-[2-[[(Z)-1-(3,5-dichlorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-4-methyltetrazol-5-one (PubChem CID 172956426) has the molecular formula C18H17Cl2N5O2 and a molecular weight of 406.27 g/mol. Its IUPAC name is 1-[2-[[(Z)-1-(3,5-dichlorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[[(Z)-1-(3,5-dichlorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 172956426 |
| Molecular Formula | C18H17Cl2N5O2 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 1-[2-[[(Z)-1-(3,5-dichlorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-4-methyltetrazol-5-one |
| SMILES | C/C(=N/OCc1c(C)cccc1-n1nnn(C)c1=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N5O2/c1-11-5-4-6-17(25-18(26)24(3)22-23-25)16(11)10-27-21-12(2)13-7-14(19)9-15(20)8-13/h4-9H,10H2,1-3H3/b21-12- |
| InChIKey | FWONLHZTHLARDB-MTJSOVHGSA-N |
| XLogP | 3.52 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|