C19H20ClN5O3 — CID 142358810
(4-chlorophenyl)methyl N-[[2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]ethanimidate (PubChem CID 142358810) has the molecular formula C19H20ClN5O3 and a molecular weight of 401.85 g/mol. Its IUPAC name is (4-chlorophenyl)methyl N-[[2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]ethanimidate.
| Compound Name | (4-chlorophenyl)methyl N-[[2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]ethanimidate |
|---|---|
| PubChem CID | 142358810 |
| Molecular Formula | C19H20ClN5O3 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (4-chlorophenyl)methyl N-[[2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]ethanimidate |
| SMILES | CC(=NOCc1c(C)cccc1-n1nnn(C)c1=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClN5O3/c1-13-5-4-6-18(25-19(26)24(3)22-23-25)17(13)12-28-21-14(2)27-11-15-7-9-16(20)10-8-15/h4-10H,11-12H2,1-3H3 |
| InChIKey | WYJQOTHVQTUQTG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|