C19H14ClF6N5O2 — CID 140694618
1-[2-[[(E)-1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-chlorophenyl]-4-methyltetrazol-5-one (PubChem CID 140694618) has the molecular formula C19H14ClF6N5O2 and a molecular weight of 493.80 g/mol. Its IUPAC name is 1-[2-[[(E)-1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-chlorophenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[[(E)-1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-chlorophenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140694618 |
| Molecular Formula | C19H14ClF6N5O2 |
| Molecular Weight | 493.80 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 1-[2-[[(E)-1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-chlorophenyl]-4-methyltetrazol-5-one |
| SMILES | C/C(=N\OCc1c(Cl)cccc1-n1nnn(C)c1=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14ClF6N5O2/c1-10(11-6-12(18(21,22)23)8-13(7-11)19(24,25)26)27-33-9-14-15(20)4-3-5-16(14)31-17(32)30(2)28-29-31/h3-8H,9H2,1-2H3/b27-10+ |
| InChIKey | IZPWPUNLONBFHX-YPXUMCKCSA-N |
| XLogP | 4.60 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|