C26H24F3N5O3 — CID 172930190
1-methyl-4-[3-methyl-2-[[3-[(Z)-C-methyl-N-[[2-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one (PubChem CID 172930190) has the molecular formula C26H24F3N5O3 and a molecular weight of 511.50 g/mol. Its IUPAC name is 1-methyl-4-[3-methyl-2-[[3-[(Z)-C-methyl-N-[[2-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-methyl-2-[[3-[(Z)-C-methyl-N-[[2-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 172930190 |
| Molecular Formula | C26H24F3N5O3 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 1-methyl-4-[3-methyl-2-[[3-[(Z)-C-methyl-N-[[2-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]methyl]phenyl]tetrazol-5-one |
| SMILES | C/C(=N/OCc1ccccc1C(F)(F)F)c1cccc(OCc2c(C)cccc2-n2nnn(C)c2=O)c1 |
| InChI | InChI=1S/C26H24F3N5O3/c1-17-8-6-13-24(34-25(35)33(3)31-32-34)22(17)16-36-21-11-7-10-19(14-21)18(2)30-37-15-20-9-4-5-12-23(20)26(27,28)29/h4-14H,15-16H2,1-3H3/b30-18- |
| InChIKey | MYVYYWBWPFOUAW-YKQZZPSBSA-N |
| XLogP | 4.81 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|