C17H15F3N4O2 — CID 118965581
1-methyl-4-[2-[(3-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl]tetrazol-5-one (PubChem CID 118965581) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is 1-methyl-4-[2-[(3-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[2-[(3-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 118965581 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-methyl-4-[2-[(3-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl]tetrazol-5-one |
| SMILES | Cc1cccc(OCc2c(-n3nnn(C)c3=O)cccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F3N4O2/c1-11-5-3-6-12(9-11)26-10-13-14(17(18,19)20)7-4-8-15(13)24-16(25)23(2)21-22-24/h3-9H,10H2,1-2H3 |
| InChIKey | OLELEHRIWQDIDE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |