C19H17F3N4O2 — CID 140803655
1-methyl-4-[3-prop-1-en-2-yl-2-[[2-(trifluoromethyl)phenoxy]methyl]phenyl]tetrazol-5-one (PubChem CID 140803655) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is 1-methyl-4-[3-prop-1-en-2-yl-2-[[2-(trifluoromethyl)phenoxy]methyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-prop-1-en-2-yl-2-[[2-(trifluoromethyl)phenoxy]methyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 140803655 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-methyl-4-[3-prop-1-en-2-yl-2-[[2-(trifluoromethyl)phenoxy]methyl]phenyl]tetrazol-5-one |
| SMILES | C=C(C)c1cccc(-n2nnn(C)c2=O)c1COc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H17F3N4O2/c1-12(2)13-7-6-9-16(26-18(27)25(3)23-24-26)14(13)11-28-17-10-5-4-8-15(17)19(20,21)22/h4-10H,1,11H2,2-3H3 |
| InChIKey | AZFYHVCIXOOSJA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |