C18H17F3N4O2S — CID 140804012
1-[2-[(2-ethylphenoxy)methyl]-3-(trifluoromethylsulfanyl)phenyl]-4-methyltetrazol-5-one (PubChem CID 140804012) has the molecular formula C18H17F3N4O2S and a molecular weight of 410.42 g/mol. Its IUPAC name is 1-[2-[(2-ethylphenoxy)methyl]-3-(trifluoromethylsulfanyl)phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(2-ethylphenoxy)methyl]-3-(trifluoromethylsulfanyl)phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140804012 |
| Molecular Formula | C18H17F3N4O2S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-[2-[(2-ethylphenoxy)methyl]-3-(trifluoromethylsulfanyl)phenyl]-4-methyltetrazol-5-one |
| SMILES | CCc1ccccc1OCc1c(SC(F)(F)F)cccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C18H17F3N4O2S/c1-3-12-7-4-5-9-15(12)27-11-13-14(25-17(26)24(2)22-23-25)8-6-10-16(13)28-18(19,20)21/h4-10H,3,11H2,1-2H3 |
| InChIKey | ZSNKHHROYDJUAV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |