C20H20N4O2 — CID 140803493
1-[2-[(2-ethylphenoxy)methyl]-3-prop-1-ynylphenyl]-4-methyltetrazol-5-one (PubChem CID 140803493) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-[2-[(2-ethylphenoxy)methyl]-3-prop-1-ynylphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(2-ethylphenoxy)methyl]-3-prop-1-ynylphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140803493 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[2-[(2-ethylphenoxy)methyl]-3-prop-1-ynylphenyl]-4-methyltetrazol-5-one |
| SMILES | CC#Cc1cccc(-n2nnn(C)c2=O)c1COc1ccccc1CC |
| InChI | InChI=1S/C20H20N4O2/c1-4-9-16-11-8-12-18(24-20(25)23(3)21-22-24)17(16)14-26-19-13-7-6-10-15(19)5-2/h6-8,10-13H,5,14H2,1-3H3 |
| InChIKey | NWVJUIQIWVYMDY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|