C18H20N4O2 — CID 118967377
1-[2-[(2-ethyl-4-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one (PubChem CID 118967377) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-[2-[(2-ethyl-4-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(2-ethyl-4-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 118967377 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-[2-[(2-ethyl-4-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one |
| SMILES | CCc1cc(C)ccc1OCc1ccccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C18H20N4O2/c1-4-14-11-13(2)9-10-17(14)24-12-15-7-5-6-8-16(15)22-18(23)21(3)19-20-22/h5-11H,4,12H2,1-3H3 |
| InChIKey | VTIUHSSLYXIFCR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |