C15H14N4O2 — CID 134251488
1-methyl-4-[2-(phenoxymethyl)phenyl]tetrazol-5-one (PubChem CID 134251488) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-methyl-4-[2-(phenoxymethyl)phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[2-(phenoxymethyl)phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 134251488 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-methyl-4-[2-(phenoxymethyl)phenyl]tetrazol-5-one |
| SMILES | Cn1nnn(-c2ccccc2COc2ccccc2)c1=O |
| InChI | InChI=1S/C15H14N4O2/c1-18-15(20)19(17-16-18)14-10-6-5-7-12(14)11-21-13-8-3-2-4-9-13/h2-10H,11H2,1H3 |
| InChIKey | JBPNVDLTGCUFGO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |