C22H20ClN5O2 — CID 121367390
1-[2-[[4-(6-chloro-2-pyridinyl)-2,5-dimethylphenoxy]methyl]phenyl]-4-methyltetrazol-5-one (PubChem CID 121367390) has the molecular formula C22H20ClN5O2 and a molecular weight of 421.89 g/mol. Its IUPAC name is 1-[2-[[4-(6-chloro-2-pyridinyl)-2,5-dimethylphenoxy]methyl]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[[4-(6-chloro-2-pyridinyl)-2,5-dimethylphenoxy]methyl]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 121367390 |
| Molecular Formula | C22H20ClN5O2 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-[2-[[4-(6-chloro-2-pyridinyl)-2,5-dimethylphenoxy]methyl]phenyl]-4-methyltetrazol-5-one |
| SMILES | Cc1cc(-c2cccc(Cl)n2)c(C)cc1OCc1ccccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C22H20ClN5O2/c1-14-12-20(15(2)11-17(14)18-8-6-10-21(23)24-18)30-13-16-7-4-5-9-19(16)28-22(29)27(3)25-26-28/h4-12H,13H2,1-3H3 |
| InChIKey | NAMZVLTYONCBSV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|