C25H24ClN5O3 — CID 172938052
1-[2-[[4-[(Z)-N-[(2-chlorophenyl)methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]methyl]phenyl]-4-methyltetrazol-5-one (PubChem CID 172938052) has the molecular formula C25H24ClN5O3 and a molecular weight of 477.95 g/mol. Its IUPAC name is 1-[2-[[4-[(Z)-N-[(2-chlorophenyl)methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]methyl]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[[4-[(Z)-N-[(2-chlorophenyl)methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]methyl]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 172938052 |
| Molecular Formula | C25H24ClN5O3 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 1-[2-[[4-[(Z)-N-[(2-chlorophenyl)methoxy]-C-methylcarbonimidoyl]-2-methylphenoxy]methyl]phenyl]-4-methyltetrazol-5-one |
| SMILES | C/C(=N/OCc1ccccc1Cl)c1ccc(OCc2ccccc2-n2nnn(C)c2=O)c(C)c1 |
| InChI | InChI=1S/C25H24ClN5O3/c1-17-14-19(18(2)27-34-16-20-8-4-6-10-22(20)26)12-13-24(17)33-15-21-9-5-7-11-23(21)31-25(32)30(3)28-29-31/h4-14H,15-16H2,1-3H3/b27-18- |
| InChIKey | DRVTUDQFRJIVED-IMRQLAEWSA-N |
| XLogP | 4.45 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|