C23H22N4O2 — CID 122506529
1-methyl-4-[3-methyl-2-[(2-methyl-4-phenylphenyl)methoxy]phenyl]tetrazol-5-one (PubChem CID 122506529) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-methyl-4-[3-methyl-2-[(2-methyl-4-phenylphenyl)methoxy]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-methyl-2-[(2-methyl-4-phenylphenyl)methoxy]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 122506529 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-methyl-4-[3-methyl-2-[(2-methyl-4-phenylphenyl)methoxy]phenyl]tetrazol-5-one |
| SMILES | Cc1cc(-c2ccccc2)ccc1COc1c(C)cccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C23H22N4O2/c1-16-8-7-11-21(27-23(28)26(3)24-25-27)22(16)29-15-20-13-12-19(14-17(20)2)18-9-5-4-6-10-18/h4-14H,15H2,1-3H3 |
| InChIKey | ACIKTXDDVYUBGG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |