C22H16F4N4O2 — CID 121381109
1-methyl-4-[3-methyl-2-[(2,3,5,6-tetrafluoro-4-phenylphenoxy)methyl]phenyl]tetrazol-5-one (PubChem CID 121381109) has the molecular formula C22H16F4N4O2 and a molecular weight of 444.39 g/mol. Its IUPAC name is 1-methyl-4-[3-methyl-2-[(2,3,5,6-tetrafluoro-4-phenylphenoxy)methyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-methyl-2-[(2,3,5,6-tetrafluoro-4-phenylphenoxy)methyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 121381109 |
| Molecular Formula | C22H16F4N4O2 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 1-methyl-4-[3-methyl-2-[(2,3,5,6-tetrafluoro-4-phenylphenoxy)methyl]phenyl]tetrazol-5-one |
| SMILES | Cc1cccc(-n2nnn(C)c2=O)c1COc1c(F)c(F)c(-c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C22H16F4N4O2/c1-12-7-6-10-15(30-22(31)29(2)27-28-30)14(12)11-32-21-19(25)17(23)16(18(24)20(21)26)13-8-4-3-5-9-13/h3-10H,11H2,1-2H3 |
| InChIKey | VVNJZICQOHZZRP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|