C16H14ClIN4O2 — CID 118535557
1-[2-[(2-chloro-4-methylphenoxy)methyl]-3-iodophenyl]-4-methyltetrazol-5-one (PubChem CID 118535557) has the molecular formula C16H14ClIN4O2 and a molecular weight of 456.67 g/mol. Its IUPAC name is 1-[2-[(2-chloro-4-methylphenoxy)methyl]-3-iodophenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(2-chloro-4-methylphenoxy)methyl]-3-iodophenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 118535557 |
| Molecular Formula | C16H14ClIN4O2 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 1-[2-[(2-chloro-4-methylphenoxy)methyl]-3-iodophenyl]-4-methyltetrazol-5-one |
| SMILES | Cc1ccc(OCc2c(I)cccc2-n2nnn(C)c2=O)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClIN4O2/c1-10-6-7-15(12(17)8-10)24-9-11-13(18)4-3-5-14(11)22-16(23)21(2)19-20-22/h3-8H,9H2,1-2H3 |
| InChIKey | QTECZINEBJRRTC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|