C13H12IN5O2S — CID 163767654
1-[3-iodo-2-[(4-methyl-1,3-thiazol-2-yl)oxymethyl]phenyl]-4-methyltetrazol-5-one (PubChem CID 163767654) has the molecular formula C13H12IN5O2S and a molecular weight of 429.24 g/mol. Its IUPAC name is 1-[3-iodo-2-[(4-methyl-1,3-thiazol-2-yl)oxymethyl]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[3-iodo-2-[(4-methyl-1,3-thiazol-2-yl)oxymethyl]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 163767654 |
| Molecular Formula | C13H12IN5O2S |
| Molecular Weight | 429.24 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | 1-[3-iodo-2-[(4-methyl-1,3-thiazol-2-yl)oxymethyl]phenyl]-4-methyltetrazol-5-one |
| SMILES | Cc1csc(OCc2c(I)cccc2-n2nnn(C)c2=O)n1 |
| InChI | InChI=1S/C13H12IN5O2S/c1-8-7-22-12(15-8)21-6-9-10(14)4-3-5-11(9)19-13(20)18(2)16-17-19/h3-5,7H,6H2,1-2H3 |
| InChIKey | MDSUHTMOIWRGOA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|