C11H12IN5O4 — CID 130318574
methyl N-[[2-iodo-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]carbamate (PubChem CID 130318574) has the molecular formula C11H12IN5O4 and a molecular weight of 405.15 g/mol. Its IUPAC name is methyl N-[[2-iodo-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]carbamate.
| Compound Name | methyl N-[[2-iodo-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]carbamate |
|---|---|
| PubChem CID | 130318574 |
| Molecular Formula | C11H12IN5O4 |
| Molecular Weight | 405.15 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | methyl N-[[2-iodo-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]carbamate |
| SMILES | COC(=O)NOCc1c(I)cccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C11H12IN5O4/c1-16-11(19)17(15-14-16)9-5-3-4-8(12)7(9)6-21-13-10(18)20-2/h3-5H,6H2,1-2H3,(H,13,18) |
| InChIKey | LQRWIHXPUAHAOX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.15 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|