C12H15N5O5 — CID 130318263
methyl N-[[2-methoxy-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]carbamate (PubChem CID 130318263) has the molecular formula C12H15N5O5 and a molecular weight of 309.28 g/mol. Its IUPAC name is methyl N-[[2-methoxy-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]carbamate.
| Compound Name | methyl N-[[2-methoxy-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]carbamate |
|---|---|
| PubChem CID | 130318263 |
| Molecular Formula | C12H15N5O5 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | methyl N-[[2-methoxy-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]carbamate |
| SMILES | COC(=O)NOCc1c(OC)cccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C12H15N5O5/c1-16-12(19)17(15-14-16)9-5-4-6-10(20-2)8(9)7-22-13-11(18)21-3/h4-6H,7H2,1-3H3,(H,13,18) |
| InChIKey | GTFLSGKTJPYOAU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|