C18H18N7O2+ — CID 144738920
1-methyl-4-[3-methyl-2-[[6-(1H-pyrazol-1-ium-5-yl)-2-pyridinyl]oxymethyl]phenyl]tetrazol-5-one (PubChem CID 144738920) has the molecular formula C18H18N7O2+ and a molecular weight of 364.39 g/mol. Its IUPAC name is 1-methyl-4-[3-methyl-2-[[6-(1H-pyrazol-1-ium-5-yl)-2-pyridinyl]oxymethyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-methyl-2-[[6-(1H-pyrazol-1-ium-5-yl)-2-pyridinyl]oxymethyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 144738920 |
| Molecular Formula | C18H18N7O2+ |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-methyl-4-[3-methyl-2-[[6-(1H-pyrazol-1-ium-5-yl)-2-pyridinyl]oxymethyl]phenyl]tetrazol-5-one |
| SMILES | Cc1cccc(-n2nnn(C)c2=O)c1COc1cccc(C2=CC=N[NH2+]2)n1 |
| InChI | InChI=1S/C18H17N7O2/c1-12-5-3-7-16(25-18(26)24(2)22-23-25)13(12)11-27-17-8-4-6-14(20-17)15-9-10-19-21-15/h3-10H,11H2,1-2H3,(H,19,21)/p+1 |
| InChIKey | OPSXOJSGZWPKQD-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|