C21H20N6O2 — CID 118965490
1-methyl-4-[3-methyl-2-[[6-(4-methylphenyl)pyrazin-2-yl]oxymethyl]phenyl]tetrazol-5-one (PubChem CID 118965490) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 1-methyl-4-[3-methyl-2-[[6-(4-methylphenyl)pyrazin-2-yl]oxymethyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-methyl-2-[[6-(4-methylphenyl)pyrazin-2-yl]oxymethyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 118965490 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-methyl-4-[3-methyl-2-[[6-(4-methylphenyl)pyrazin-2-yl]oxymethyl]phenyl]tetrazol-5-one |
| SMILES | Cc1ccc(-c2cncc(OCc3c(C)cccc3-n3nnn(C)c3=O)n2)cc1 |
| InChI | InChI=1S/C21H20N6O2/c1-14-7-9-16(10-8-14)18-11-22-12-20(23-18)29-13-17-15(2)5-4-6-19(17)27-21(28)26(3)24-25-27/h4-12H,13H2,1-3H3 |
| InChIKey | DLHZZXPTJPQHNF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |