C17H14ClN5O2 — CID 140803904
1-[2-[(2-chloro-5-methylphenoxy)methyl]-3-isocyanophenyl]-4-methyltetrazol-5-one (PubChem CID 140803904) has the molecular formula C17H14ClN5O2 and a molecular weight of 355.79 g/mol. Its IUPAC name is 1-[2-[(2-chloro-5-methylphenoxy)methyl]-3-isocyanophenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(2-chloro-5-methylphenoxy)methyl]-3-isocyanophenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140803904 |
| Molecular Formula | C17H14ClN5O2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 1-[2-[(2-chloro-5-methylphenoxy)methyl]-3-isocyanophenyl]-4-methyltetrazol-5-one |
| SMILES | [C-]#[N+]c1cccc(-n2nnn(C)c2=O)c1COc1cc(C)ccc1Cl |
| InChI | InChI=1S/C17H14ClN5O2/c1-11-7-8-13(18)16(9-11)25-10-12-14(19-2)5-4-6-15(12)23-17(24)22(3)20-21-23/h4-9H,10H2,1,3H3 |
| InChIKey | NCOZLLWKSZFUIJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|