C18H16N4O2 — CID 140803984
1-[3-ethynyl-2-[(2-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one (PubChem CID 140803984) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-[3-ethynyl-2-[(2-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[3-ethynyl-2-[(2-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140803984 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[3-ethynyl-2-[(2-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one |
| SMILES | C#Cc1cccc(-n2nnn(C)c2=O)c1COc1ccccc1C |
| InChI | InChI=1S/C18H16N4O2/c1-4-14-9-7-10-16(22-18(23)21(3)19-20-22)15(14)12-24-17-11-6-5-8-13(17)2/h1,5-11H,12H2,2-3H3 |
| InChIKey | RBJKDGYMYQSAFD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|