C17H15N5O2 — CID 140740131
1-[2-ethynyl-3-[(2-methyl-4-tritiophenoxy)methyl]-4-pyridinyl]-4-methyltetrazol-5-one (PubChem CID 140740131) has the molecular formula C17H15N5O2 and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-[2-ethynyl-3-[(2-methyl-4-tritiophenoxy)methyl]-4-pyridinyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-ethynyl-3-[(2-methyl-4-tritiophenoxy)methyl]-4-pyridinyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140740131 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-[2-ethynyl-3-[(2-methyl-4-tritiophenoxy)methyl]-4-pyridinyl]-4-methyltetrazol-5-one |
| SMILES | [3H]c1ccc(OCc2c(-n3nnn(C)c3=O)ccnc2C#C)c(C)c1 |
| InChI | InChI=1S/C17H15N5O2/c1-4-14-13(11-24-16-8-6-5-7-12(16)2)15(9-10-18-14)22-17(23)21(3)19-20-22/h1,5-10H,11H2,2-3H3/i5T |
| InChIKey | NIRWRGQFJQPJJB-XHHURNKPSA-N |
| XLogP | 1.23 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|