C16H14N6O2 — CID 140740837
1-[5-ethynyl-4-[(2-methyl-4-tritiophenoxy)methyl]pyridazin-3-yl]-4-methyltetrazol-5-one (PubChem CID 140740837) has the molecular formula C16H14N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-[5-ethynyl-4-[(2-methyl-4-tritiophenoxy)methyl]pyridazin-3-yl]-4-methyltetrazol-5-one.
| Compound Name | 1-[5-ethynyl-4-[(2-methyl-4-tritiophenoxy)methyl]pyridazin-3-yl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140740837 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[5-ethynyl-4-[(2-methyl-4-tritiophenoxy)methyl]pyridazin-3-yl]-4-methyltetrazol-5-one |
| SMILES | [3H]c1ccc(OCc2c(C#C)cnnc2-n2nnn(C)c2=O)c(C)c1 |
| InChI | InChI=1S/C16H14N6O2/c1-4-12-9-17-18-15(22-16(23)21(3)19-20-22)13(12)10-24-14-8-6-5-7-11(14)2/h1,5-9H,10H2,2-3H3/i5T |
| InChIKey | XPDZZJOYYLTLRY-XHHURNKPSA-N |
| XLogP | 0.62 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|