C13H14N6O2 — CID 140740286
1-methyl-4-[5-[(2-methyl-4-tritiophenoxy)methyl]-1H-pyrazol-4-yl]tetrazol-5-one (PubChem CID 140740286) has the molecular formula C13H14N6O2 and a molecular weight of 288.30 g/mol. Its IUPAC name is 1-methyl-4-[5-[(2-methyl-4-tritiophenoxy)methyl]-1H-pyrazol-4-yl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[5-[(2-methyl-4-tritiophenoxy)methyl]-1H-pyrazol-4-yl]tetrazol-5-one |
|---|---|
| PubChem CID | 140740286 |
| Molecular Formula | C13H14N6O2 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-methyl-4-[5-[(2-methyl-4-tritiophenoxy)methyl]-1H-pyrazol-4-yl]tetrazol-5-one |
| SMILES | [3H]c1ccc(OCc2[nH]ncc2-n2nnn(C)c2=O)c(C)c1 |
| InChI | InChI=1S/C13H14N6O2/c1-9-5-3-4-6-12(9)21-8-10-11(7-14-15-10)19-13(20)18(2)16-17-19/h3-7H,8H2,1-2H3,(H,14,15)/i3T |
| InChIKey | YGTMGHIFLPHINY-WJULDGBESA-N |
| XLogP | 0.58 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |