C15H14FN5O2 — CID 140740116
1-[5-fluoro-4-[(2-methyl-4-tritiophenoxy)methyl]-3-pyridinyl]-4-methyltetrazol-5-one (PubChem CID 140740116) has the molecular formula C15H14FN5O2 and a molecular weight of 317.32 g/mol. Its IUPAC name is 1-[5-fluoro-4-[(2-methyl-4-tritiophenoxy)methyl]-3-pyridinyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[5-fluoro-4-[(2-methyl-4-tritiophenoxy)methyl]-3-pyridinyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140740116 |
| Molecular Formula | C15H14FN5O2 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-[5-fluoro-4-[(2-methyl-4-tritiophenoxy)methyl]-3-pyridinyl]-4-methyltetrazol-5-one |
| SMILES | [3H]c1ccc(OCc2c(F)cncc2-n2nnn(C)c2=O)c(C)c1 |
| InChI | InChI=1S/C15H14FN5O2/c1-10-5-3-4-6-14(10)23-9-11-12(16)7-17-8-13(11)21-15(22)20(2)18-19-21/h3-8H,9H2,1-2H3/i3T |
| InChIKey | QXBUIMUTFVZFDE-WJULDGBESA-N |
| XLogP | 1.39 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |