C14H16N6O2 — CID 140740632
1-methyl-4-[1-methyl-3-[(2-methyl-4-tritiophenoxy)methyl]pyrazol-4-yl]tetrazol-5-one (PubChem CID 140740632) has the molecular formula C14H16N6O2 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-methyl-4-[1-methyl-3-[(2-methyl-4-tritiophenoxy)methyl]pyrazol-4-yl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[1-methyl-3-[(2-methyl-4-tritiophenoxy)methyl]pyrazol-4-yl]tetrazol-5-one |
|---|---|
| PubChem CID | 140740632 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-methyl-4-[1-methyl-3-[(2-methyl-4-tritiophenoxy)methyl]pyrazol-4-yl]tetrazol-5-one |
| SMILES | [3H]c1ccc(OCc2nn(C)cc2-n2nnn(C)c2=O)c(C)c1 |
| InChI | InChI=1S/C14H16N6O2/c1-10-6-4-5-7-13(10)22-9-11-12(8-18(2)15-11)20-14(21)19(3)16-17-20/h4-8H,9H2,1-3H3/i4T |
| InChIKey | CAEDRTZILUOJPI-IBTRZKOZSA-N |
| XLogP | 0.59 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |