C16H18N4O2S — CID 140740561
1-[4-ethyl-3-[(2-methyl-4-tritiophenoxy)methyl]thiophen-2-yl]-4-methyltetrazol-5-one (PubChem CID 140740561) has the molecular formula C16H18N4O2S and a molecular weight of 332.42 g/mol. Its IUPAC name is 1-[4-ethyl-3-[(2-methyl-4-tritiophenoxy)methyl]thiophen-2-yl]-4-methyltetrazol-5-one.
| Compound Name | 1-[4-ethyl-3-[(2-methyl-4-tritiophenoxy)methyl]thiophen-2-yl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140740561 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-[4-ethyl-3-[(2-methyl-4-tritiophenoxy)methyl]thiophen-2-yl]-4-methyltetrazol-5-one |
| SMILES | [3H]c1ccc(OCc2c(CC)csc2-n2nnn(C)c2=O)c(C)c1 |
| InChI | InChI=1S/C16H18N4O2S/c1-4-12-10-23-15(20-16(21)19(3)17-18-20)13(12)9-22-14-8-6-5-7-11(14)2/h5-8,10H,4,9H2,1-3H3/i5T |
| InChIKey | MUFGYOJFZKBVBX-XHHURNKPSA-N |
| XLogP | 2.48 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |