C18H12ClF3N4O2 — CID 140803884
1-[2-[[5-chloro-2-(trifluoromethyl)phenoxy]methyl]-3-ethynylphenyl]-4-methyltetrazol-5-one (PubChem CID 140803884) has the molecular formula C18H12ClF3N4O2 and a molecular weight of 408.77 g/mol. Its IUPAC name is 1-[2-[[5-chloro-2-(trifluoromethyl)phenoxy]methyl]-3-ethynylphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[[5-chloro-2-(trifluoromethyl)phenoxy]methyl]-3-ethynylphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140803884 |
| Molecular Formula | C18H12ClF3N4O2 |
| Molecular Weight | 408.77 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 1-[2-[[5-chloro-2-(trifluoromethyl)phenoxy]methyl]-3-ethynylphenyl]-4-methyltetrazol-5-one |
| SMILES | C#Cc1cccc(-n2nnn(C)c2=O)c1COc1cc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C18H12ClF3N4O2/c1-3-11-5-4-6-15(26-17(27)25(2)23-24-26)13(11)10-28-16-9-12(19)7-8-14(16)18(20,21)22/h1,4-9H,10H2,2H3 |
| InChIKey | PTFKDJSRIQMVKG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|