C23H27F3N5O2+ — CID 118411899
1,4-dimethyl-1-[3-methyl-2-[[[3-methyl-1-[3-(trifluoromethyl)phenyl]butylidene]amino]oxymethyl]phenyl]tetrazol-1-ium-5-one (PubChem CID 118411899) has the molecular formula C23H27F3N5O2+ and a molecular weight of 462.50 g/mol. Its IUPAC name is 1,4-dimethyl-1-[3-methyl-2-[[[3-methyl-1-[3-(trifluoromethyl)phenyl]butylidene]amino]oxymethyl]phenyl]tetrazol-1-ium-5-one.
| Compound Name | 1,4-dimethyl-1-[3-methyl-2-[[[3-methyl-1-[3-(trifluoromethyl)phenyl]butylidene]amino]oxymethyl]phenyl]tetrazol-1-ium-5-one |
|---|---|
| PubChem CID | 118411899 |
| Molecular Formula | C23H27F3N5O2+ |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 1,4-dimethyl-1-[3-methyl-2-[[[3-methyl-1-[3-(trifluoromethyl)phenyl]butylidene]amino]oxymethyl]phenyl]tetrazol-1-ium-5-one |
| SMILES | Cc1cccc([N+]2(C)N=NN(C)C2=O)c1CON=C(CC(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H27F3N5O2/c1-15(2)12-20(17-9-7-10-18(13-17)23(24,25)26)27-33-14-19-16(3)8-6-11-21(19)31(5)22(32)30(4)28-29-31/h6-11,13,15H,12,14H2,1-5H3/q+1 |
| InChIKey | MIXGDCQJOZPFCL-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 66.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|