C16H15F6N3O2 — CID 175955178
(Z)-N-ethoxy-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-1-[3-(trifluoromethyl)phenyl]ethanimine (PubChem CID 175955178) has the molecular formula C16H15F6N3O2 and a molecular weight of 395.30 g/mol. Its IUPAC name is (Z)-N-ethoxy-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-1-[3-(trifluoromethyl)phenyl]ethanimine.
| Compound Name | (Z)-N-ethoxy-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-1-[3-(trifluoromethyl)phenyl]ethanimine |
|---|---|
| PubChem CID | 175955178 |
| Molecular Formula | C16H15F6N3O2 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (Z)-N-ethoxy-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-1-[3-(trifluoromethyl)phenyl]ethanimine |
| SMILES | CCO/N=C(\COc1cc(C(F)(F)F)nn1C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F6N3O2/c1-3-27-24-12(10-5-4-6-11(7-10)15(17,18)19)9-26-14-8-13(16(20,21)22)23-25(14)2/h4-8H,3,9H2,1-2H3/b24-12+ |
| InChIKey | BLLVIDBULBWBHQ-WYMPLXKRSA-N |
| XLogP | 4.28 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|