C12H8ClF3N2O2 — CID 2807373
[1-methyl-3-(trifluoromethyl)pyrazol-5-yl] 2-chlorobenzoate (PubChem CID 2807373) has the molecular formula C12H8ClF3N2O2 and a molecular weight of 304.65 g/mol. Its IUPAC name is [1-methyl-3-(trifluoromethyl)pyrazol-5-yl] 2-chlorobenzoate.
| Compound Name | [1-methyl-3-(trifluoromethyl)pyrazol-5-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 2807373 |
| Molecular Formula | C12H8ClF3N2O2 |
| Molecular Weight | 304.65 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | [1-methyl-3-(trifluoromethyl)pyrazol-5-yl] 2-chlorobenzoate |
| SMILES | Cn1nc(C(F)(F)F)cc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C12H8ClF3N2O2/c1-18-10(6-9(17-18)12(14,15)16)20-11(19)7-4-2-3-5-8(7)13/h2-6H,1H3 |
| InChIKey | FDHAMSDPHDYOSJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.65 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |