C12H8F6N2O3S — CID 2807897
[1-methyl-3-(trifluoromethyl)pyrazol-5-yl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 2807897) has the molecular formula C12H8F6N2O3S and a molecular weight of 374.26 g/mol. Its IUPAC name is [1-methyl-3-(trifluoromethyl)pyrazol-5-yl] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [1-methyl-3-(trifluoromethyl)pyrazol-5-yl] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 2807897 |
| Molecular Formula | C12H8F6N2O3S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | [1-methyl-3-(trifluoromethyl)pyrazol-5-yl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | Cn1nc(C(F)(F)F)cc1OS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H8F6N2O3S/c1-20-10(6-9(19-20)12(16,17)18)23-24(21,22)8-4-2-7(3-5-8)11(13,14)15/h2-6H,1H3 |
| InChIKey | IBTVUWXVJVOORJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|