C18H16F2N2O3S — CID 21314307
[2-[1-(4-fluorophenyl)ethyl]-5-methylpyrazol-3-yl] 4-fluorobenzenesulfonate (PubChem CID 21314307) has the molecular formula C18H16F2N2O3S and a molecular weight of 378.40 g/mol. Its IUPAC name is [2-[1-(4-fluorophenyl)ethyl]-5-methylpyrazol-3-yl] 4-fluorobenzenesulfonate.
| Compound Name | [2-[1-(4-fluorophenyl)ethyl]-5-methylpyrazol-3-yl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 21314307 |
| Molecular Formula | C18H16F2N2O3S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [2-[1-(4-fluorophenyl)ethyl]-5-methylpyrazol-3-yl] 4-fluorobenzenesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)c2ccc(F)cc2)n(C(C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H16F2N2O3S/c1-12-11-18(25-26(23,24)17-9-7-16(20)8-10-17)22(21-12)13(2)14-3-5-15(19)6-4-14/h3-11,13H,1-2H3 |
| InChIKey | AZEKOUYGOCONLA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|