C19H15ClF3N3O2 — CID 67468607
2-chloro-N-[2-methoxy-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]benzamide (PubChem CID 67468607) has the molecular formula C19H15ClF3N3O2 and a molecular weight of 409.80 g/mol. Its IUPAC name is 2-chloro-N-[2-methoxy-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[2-methoxy-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 67468607 |
| Molecular Formula | C19H15ClF3N3O2 |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-chloro-N-[2-methoxy-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]benzamide |
| SMILES | COc1cc(-c2cc(C(F)(F)F)nn2C)ccc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H15ClF3N3O2/c1-26-15(10-17(25-26)19(21,22)23)11-7-8-14(16(9-11)28-2)24-18(27)12-5-3-4-6-13(12)20/h3-10H,1-2H3,(H,24,27) |
| InChIKey | HWTIJAHCUSPCML-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |